C18H19N3O3S — CID 21010232
propan-2-yl 4-(4-hydroxy-2-methylanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 21010232) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is propan-2-yl 4-(4-hydroxy-2-methylanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | propan-2-yl 4-(4-hydroxy-2-methylanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 21010232 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | propan-2-yl 4-(4-hydroxy-2-methylanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | Cc1cc(O)ccc1Nc1ncnc2sc(C(=O)OC(C)C)c(C)c12 |
| InChI | InChI=1S/C18H19N3O3S/c1-9(2)24-18(23)15-11(4)14-16(19-8-20-17(14)25-15)21-13-6-5-12(22)7-10(13)3/h5-9,22H,1-4H3,(H,19,20,21) |
| InChIKey | BUHBGSTZYCULTQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|