C18H17N3O5S — CID 21011798
2-hydroxy-5-[(5-methyl-6-propan-2-yloxycarbonylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid (PubChem CID 21011798) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 2-hydroxy-5-[(5-methyl-6-propan-2-yloxycarbonylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[(5-methyl-6-propan-2-yloxycarbonylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 21011798 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-hydroxy-5-[(5-methyl-6-propan-2-yloxycarbonylthieno[2,3-d]pyrimidin-4-yl)amino]benzoic acid |
| SMILES | Cc1c(C(=O)OC(C)C)sc2ncnc(Nc3ccc(O)c(C(=O)O)c3)c12 |
| InChI | InChI=1S/C18H17N3O5S/c1-8(2)26-18(25)14-9(3)13-15(19-7-20-16(13)27-14)21-10-4-5-12(22)11(6-10)17(23)24/h4-8,22H,1-3H3,(H,23,24)(H,19,20,21) |
| InChIKey | LSPDJBVGTCCYJS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|