C18H20N4O2S — CID 28850087
2-methylpropyl 4-(4-aminoanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 28850087) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-methylpropyl 4-(4-aminoanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-methylpropyl 4-(4-aminoanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 28850087 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2-methylpropyl 4-(4-aminoanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | Cc1c(C(=O)OCC(C)C)sc2ncnc(Nc3ccc(N)cc3)c12 |
| InChI | InChI=1S/C18H20N4O2S/c1-10(2)8-24-18(23)15-11(3)14-16(20-9-21-17(14)25-15)22-13-6-4-12(19)5-7-13/h4-7,9-10H,8,19H2,1-3H3,(H,20,21,22) |
| InChIKey | ARPFEGLFTDDERB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|