C19H21N3O3S — CID 28853426
2-methylpropyl 4-(4-hydroxyanilino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 28853426) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-methylpropyl 4-(4-hydroxyanilino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-methylpropyl 4-(4-hydroxyanilino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 28853426 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-methylpropyl 4-(4-hydroxyanilino)-2,5-dimethylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | Cc1nc(Nc2ccc(O)cc2)c2c(C)c(C(=O)OCC(C)C)sc2n1 |
| InChI | InChI=1S/C19H21N3O3S/c1-10(2)9-25-19(24)16-11(3)15-17(20-12(4)21-18(15)26-16)22-13-5-7-14(23)8-6-13/h5-8,10,23H,9H2,1-4H3,(H,20,21,22) |
| InChIKey | RJTGTDTXDBADJU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|