C22H27N3O3S — CID 20998767
2-methylpropyl 4-(4-butoxyanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 20998767) has the molecular formula C22H27N3O3S and a molecular weight of 413.54 g/mol. Its IUPAC name is 2-methylpropyl 4-(4-butoxyanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-methylpropyl 4-(4-butoxyanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 20998767 |
| Molecular Formula | C22H27N3O3S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 2-methylpropyl 4-(4-butoxyanilino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCCCOc1ccc(Nc2ncnc3sc(C(=O)OCC(C)C)c(C)c23)cc1 |
| InChI | InChI=1S/C22H27N3O3S/c1-5-6-11-27-17-9-7-16(8-10-17)25-20-18-15(4)19(22(26)28-12-14(2)3)29-21(18)24-13-23-20/h7-10,13-14H,5-6,11-12H2,1-4H3,(H,23,24,25) |
| InChIKey | UQQBMCLGIKFHFF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|