C15H15N3OS — CID 28851372
4-[(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)amino]phenol (PubChem CID 28851372) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is 4-[(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)amino]phenol.
| Compound Name | 4-[(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)amino]phenol |
|---|---|
| PubChem CID | 28851372 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 4-[(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)amino]phenol |
| SMILES | Cc1nc(Nc2ccc(O)cc2)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C15H15N3OS/c1-8-9(2)20-15-13(8)14(16-10(3)17-15)18-11-4-6-12(19)7-5-11/h4-7,19H,1-3H3,(H,16,17,18) |
| InChIKey | PIIUPWSGGOSUPH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|