C19H11ClN4S2 — CID 21012078
[4-[[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]phenyl] thiocyanate (PubChem CID 21012078) has the molecular formula C19H11ClN4S2 and a molecular weight of 394.91 g/mol. Its IUPAC name is [4-[[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 21012078 |
| Molecular Formula | C19H11ClN4S2 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | [4-[[5-(4-chlorophenyl)thieno[2,3-d]pyrimidin-4-yl]amino]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(Nc2ncnc3scc(-c4ccc(Cl)cc4)c23)cc1 |
| InChI | InChI=1S/C19H11ClN4S2/c20-13-3-1-12(2-4-13)16-9-25-19-17(16)18(22-11-23-19)24-14-5-7-15(8-6-14)26-10-21/h1-9,11H,(H,22,23,24) |
| InChIKey | GCPHCJQUBFBVSR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|