C11H25N3O3 — CID 21016265
2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide (PubChem CID 21016265) has the molecular formula C11H25N3O3 and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 21016265 |
| Molecular Formula | C11H25N3O3 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide |
| SMILES | CCCC(N)C(O)C(O)NCC(=O)NC(C)C |
| InChI | InChI=1S/C11H25N3O3/c1-4-5-8(12)10(16)11(17)13-6-9(15)14-7(2)3/h7-8,10-11,13,16-17H,4-6,12H2,1-3H3,(H,14,15) |
| InChIKey | PRKCFRDAGKBPMV-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|