About 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide
2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide (PubChem CID 21016265) has the molecular formula C11H25N3O3
and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide |
| PubChem CID | 21016265 |
| Molecular Formula | C11H25N3O3 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide |
| SMILES | CCCC(N)C(O)C(O)NCC(=O)NC(C)C |
| InChI | InChI=1S/C11H25N3O3/c1-4-5-8(12)10(16)11(17)13-6-9(15)14-7(2)3/h7-8,10-11,13,16-17H,4-6,12H2,1-3H3,(H,14,15) |
| InChIKey | PRKCFRDAGKBPMV-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide?
The IUPAC name of 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide (CID 21016265) is 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide.
What is the SMILES notation for 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide?
The canonical SMILES for 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide is CCCC(N)C(O)C(O)NCC(=O)NC(C)C.
What is the InChIKey of 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide?
The InChIKey is PRKCFRDAGKBPMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3O3/c1-4-5-8(12)10(16)11(17)13-6-9(15)14-7(2)3/h7-8,10-11,13,16-17H,4-6,12H2,1-3H3,(H,14,15).
What are the key properties of 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide?
2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide has a molecular weight of 247.34 g/mol, XLogP of -1.09, 8 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-amino-1,2-dihydroxyhexyl)amino]-N-propan-2-ylacetamide is sourced from PubChem (CID 21016265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).