C11H24N2O3 — CID 59115752
2-[[(1S)-1,2-dihydroxy-3-methylpentyl]amino]-N-propan-2-ylacetamide (PubChem CID 59115752) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is 2-[[(1S)-1,2-dihydroxy-3-methylpentyl]amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[[(1S)-1,2-dihydroxy-3-methylpentyl]amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 59115752 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 2-[[(1S)-1,2-dihydroxy-3-methylpentyl]amino]-N-propan-2-ylacetamide |
| SMILES | CCC(C)C(O)[C@H](O)NCC(=O)NC(C)C |
| InChI | InChI=1S/C11H24N2O3/c1-5-8(4)10(15)11(16)12-6-9(14)13-7(2)3/h7-8,10-12,15-16H,5-6H2,1-4H3,(H,13,14)/t8?,10?,11-/m0/s1 |
| InChIKey | NZQFZLGNUKHAJX-RFBVYIQQSA-N |
| XLogP | -0.17 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|