C10H15NO4 — CID 21016594
6-ethoxycarbonyl-3-methyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (PubChem CID 21016594) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 6-ethoxycarbonyl-3-methyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid.
| Compound Name | 6-ethoxycarbonyl-3-methyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
|---|---|
| PubChem CID | 21016594 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 6-ethoxycarbonyl-3-methyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| SMILES | CCOC(=O)C1C2CN(C)C(C(=O)O)C21 |
| InChI | InChI=1S/C10H15NO4/c1-3-15-10(14)7-5-4-11(2)8(6(5)7)9(12)13/h5-8H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | QILQJINGFZJJIN-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |