C28H30N4O5 — CID 2101977
5,5-bis[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 2101977) has the molecular formula C28H30N4O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is 5,5-bis[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-bis[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2101977 |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 5,5-bis[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)N(C)C(=O)C(CC(=O)N2CCCc3ccccc32)(CC(=O)N2CCCc3ccccc32)C1=O |
| InChI | InChI=1S/C28H30N4O5/c1-29-25(35)28(26(36)30(2)27(29)37,17-23(33)31-15-7-11-19-9-3-5-13-21(19)31)18-24(34)32-16-8-12-20-10-4-6-14-22(20)32/h3-6,9-10,13-14H,7-8,11-12,15-18H2,1-2H3 |
| InChIKey | QSZWMBUXYFEOLK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|