C16H19NO6 — CID 21020239
4-ethoxycarbonyl-4-(2-nitrophenyl)hept-6-enoic acid (PubChem CID 21020239) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is 4-ethoxycarbonyl-4-(2-nitrophenyl)hept-6-enoic acid.
| Compound Name | 4-ethoxycarbonyl-4-(2-nitrophenyl)hept-6-enoic acid |
|---|---|
| PubChem CID | 21020239 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 4-ethoxycarbonyl-4-(2-nitrophenyl)hept-6-enoic acid |
| SMILES | C=CCC(CCC(=O)O)(C(=O)OCC)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19NO6/c1-3-10-16(11-9-14(18)19,15(20)23-4-2)12-7-5-6-8-13(12)17(21)22/h3,5-8H,1,4,9-11H2,2H3,(H,18,19) |
| InChIKey | DSUJJBQLAZQSFJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|