C10H10F9NO — CID 21020691
2-methyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)prop-2-enamide (PubChem CID 21020691) has the molecular formula C10H10F9NO and a molecular weight of 331.18 g/mol. Its IUPAC name is 2-methyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)prop-2-enamide.
| Compound Name | 2-methyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 21020691 |
| Molecular Formula | C10H10F9NO |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 2-methyl-N-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F9NO/c1-5(2)6(21)20-4-3-7(11,12)8(13,14)9(15,16)10(17,18)19/h1,3-4H2,2H3,(H,20,21) |
| InChIKey | RLPSTVNLHAHWST-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|