C24H25N2O+ — CID 2102100
[(2S)-2-hydroxy-2-phenylethyl]-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]azanium (PubChem CID 2102100) has the molecular formula C24H25N2O+ and a molecular weight of 357.48 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-phenylethyl]-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]azanium.
| Compound Name | [(2S)-2-hydroxy-2-phenylethyl]-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]azanium |
|---|---|
| PubChem CID | 2102100 |
| Molecular Formula | C24H25N2O+ |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | [(2S)-2-hydroxy-2-phenylethyl]-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]azanium |
| SMILES | O[C@H](C[NH2+]C[C@@H](c1ccccc1)c1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O/c27-24(19-11-5-2-6-12-19)17-25-15-21(18-9-3-1-4-10-18)22-16-26-23-14-8-7-13-20(22)23/h1-14,16,21,24-27H,15,17H2/p+1/t21-,24+/m0/s1 |
| InChIKey | QCGLKDCOPKXQOP-XUZZJYLKSA-O |
| XLogP | 3.60 |
| TPSA | 52.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |