C22H26N3O+ — CID 8645346
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl]-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]azanium (PubChem CID 8645346) has the molecular formula C22H26N3O+ and a molecular weight of 348.47 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl]-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]azanium.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl]-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]azanium |
|---|---|
| PubChem CID | 8645346 |
| Molecular Formula | C22H26N3O+ |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl]-[(2S)-2-(1H-indol-3-yl)-2-phenylethyl]azanium |
| SMILES | C[C@H]([NH2+]C[C@@H](c1ccccc1)c1c[nH]c2ccccc12)C(=O)NC1CC1 |
| InChI | InChI=1S/C22H25N3O/c1-15(22(26)25-17-11-12-17)23-13-19(16-7-3-2-4-8-16)20-14-24-21-10-6-5-9-18(20)21/h2-10,14-15,17,19,23-24H,11-13H2,1H3,(H,25,26)/p+1/t15-,19-/m0/s1 |
| InChIKey | ASNLVUFOPYWOJC-KXBFYZLASA-O |
| XLogP | 2.53 |
| TPSA | 61.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |