C25H33N4O+ — CID 9328017
[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]azanium (PubChem CID 9328017) has the molecular formula C25H33N4O+ and a molecular weight of 405.57 g/mol. Its IUPAC name is [(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]azanium.
| Compound Name | [(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 9328017 |
| Molecular Formula | C25H33N4O+ |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | [(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]azanium |
| SMILES | C[C@H]([NH2+]C[C@@H](c1ccc(N(C)C)cc1)c1c[nH]c2ccccc12)C(=O)N1CCCC1 |
| InChI | InChI=1S/C25H32N4O/c1-18(25(30)29-14-6-7-15-29)26-16-22(19-10-12-20(13-11-19)28(2)3)23-17-27-24-9-5-4-8-21(23)24/h4-5,8-13,17-18,22,26-27H,6-7,14-16H2,1-3H3/p+1/t18-,22-/m0/s1 |
| InChIKey | MLVXLWPQCTXYQK-AVRDEDQJSA-O |
| XLogP | 2.94 |
| TPSA | 55.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|