C18H26N2O3 — CID 21021946
(E)-3-[4-[4-(2-hydroxybutylamino)piperidin-1-yl]phenyl]prop-2-enoic acid (PubChem CID 21021946) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (E)-3-[4-[4-(2-hydroxybutylamino)piperidin-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[4-(2-hydroxybutylamino)piperidin-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 21021946 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (E)-3-[4-[4-(2-hydroxybutylamino)piperidin-1-yl]phenyl]prop-2-enoic acid |
| SMILES | CCC(O)CNC1CCN(c2ccc(/C=C/C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C18H26N2O3/c1-2-17(21)13-19-15-9-11-20(12-10-15)16-6-3-14(4-7-16)5-8-18(22)23/h3-8,15,17,19,21H,2,9-13H2,1H3,(H,22,23)/b8-5+ |
| InChIKey | PNJWSYZBGPXSEV-VMPITWQZSA-N |
| XLogP | 2.11 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|