(E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid

C16H21NO2 — CID 113290768

IUPAC(E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid
SMILESCCC1(CC)CN(c2ccc(/C=C/C(=O)O)cc2)C1
InChIInChI=1S/C16H21NO2/c1-3-16(4-2)11-17(12-16)14-8-5-13(6-9-14)7-10-15(18)19/h5-10H,3-4,11-12H2,1-2H3,(H,18,19)/b10-7+
InChIKeyOWBANCNXOJWGCW-JXMROGBWSA-N
MW259.35 g/mol
LogP3.41
Rot. Bonds5

About (E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid

(E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid (PubChem CID 113290768) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid
PubChem CID113290768
Molecular FormulaC16H21NO2
Molecular Weight259.35 g/mol
Exact Mass259.16
IUPAC Name(E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid
SMILESCCC1(CC)CN(c2ccc(/C=C/C(=O)O)cc2)C1
InChIInChI=1S/C16H21NO2/c1-3-16(4-2)11-17(12-16)14-8-5-13(6-9-14)7-10-15(18)19/h5-10H,3-4,11-12H2,1-2H3,(H,18,19)/b10-7+
InChIKeyOWBANCNXOJWGCW-JXMROGBWSA-N
XLogP3.41
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.35
LogP ≤ 53.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid?
The IUPAC name of (E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid (CID 113290768) is (E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid.
What is the SMILES notation for (E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid?
The canonical SMILES for (E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid is CCC1(CC)CN(c2ccc(/C=C/C(=O)O)cc2)C1.
What is the InChIKey of (E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid?
The InChIKey is OWBANCNXOJWGCW-JXMROGBWSA-N. The full InChI is InChI=1S/C16H21NO2/c1-3-16(4-2)11-17(12-16)14-8-5-13(6-9-14)7-10-15(18)19/h5-10H,3-4,11-12H2,1-2H3,(H,18,19)/b10-7+.
What are the key properties of (E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid?
(E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid has a molecular weight of 259.35 g/mol, XLogP of 3.41, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[4-(3,3-diethylazetidin-1-yl)phenyl]prop-2-enoic acid is sourced from PubChem (CID 113290768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).