C9H14NO3S+ — CID 21021978
ethyl 2-[2-(1-hydroxyethyl)-1,3-thiazol-3-ium-3-yl]acetate (PubChem CID 21021978) has the molecular formula C9H14NO3S+ and a molecular weight of 216.28 g/mol. Its IUPAC name is ethyl 2-[2-(1-hydroxyethyl)-1,3-thiazol-3-ium-3-yl]acetate.
| Compound Name | ethyl 2-[2-(1-hydroxyethyl)-1,3-thiazol-3-ium-3-yl]acetate |
|---|---|
| PubChem CID | 21021978 |
| Molecular Formula | C9H14NO3S+ |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | ethyl 2-[2-(1-hydroxyethyl)-1,3-thiazol-3-ium-3-yl]acetate |
| SMILES | CCOC(=O)C[n+]1ccsc1C(C)O |
| InChI | InChI=1S/C9H14NO3S/c1-3-13-8(12)6-10-4-5-14-9(10)7(2)11/h4-5,7,11H,3,6H2,1-2H3/q+1 |
| InChIKey | GUUJXGKMLSYWTL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|