C12H15N2O2+ — CID 15105600
ethyl 2-(1-methylpyrrolo[1,2-a]pyrazin-2-ium-2-yl)acetate (PubChem CID 15105600) has the molecular formula C12H15N2O2+ and a molecular weight of 219.26 g/mol. Its IUPAC name is ethyl 2-(1-methylpyrrolo[1,2-a]pyrazin-2-ium-2-yl)acetate.
| Compound Name | ethyl 2-(1-methylpyrrolo[1,2-a]pyrazin-2-ium-2-yl)acetate |
|---|---|
| PubChem CID | 15105600 |
| Molecular Formula | C12H15N2O2+ |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | ethyl 2-(1-methylpyrrolo[1,2-a]pyrazin-2-ium-2-yl)acetate |
| SMILES | CCOC(=O)C[n+]1ccn2cccc2c1C |
| InChI | InChI=1S/C12H15N2O2/c1-3-16-12(15)9-14-8-7-13-6-4-5-11(13)10(14)2/h4-8H,3,9H2,1-2H3/q+1 |
| InChIKey | NICJSCKSWYOJIP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|