C24H21ClN2O7 — CID 2102276
[2-[1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 5-chloro-2-nitrobenzoate (PubChem CID 2102276) has the molecular formula C24H21ClN2O7 and a molecular weight of 484.89 g/mol. Its IUPAC name is [2-[1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 5-chloro-2-nitrobenzoate.
| Compound Name | [2-[1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 5-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 2102276 |
| Molecular Formula | C24H21ClN2O7 |
| Molecular Weight | 484.89 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | [2-[1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl] 5-chloro-2-nitrobenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2cc(Cl)ccc2[N+](=O)[O-])c(C)n1C[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C24H21ClN2O7/c1-14-9-18(15(2)26(14)11-17-12-32-22-5-3-4-6-23(22)34-17)21(28)13-33-24(29)19-10-16(25)7-8-20(19)27(30)31/h3-10,17H,11-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | VBKRBJMQTWRKFJ-QGZVFWFLSA-N |
| XLogP | 4.55 |
| TPSA | 109.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.89 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|