About bis(2-phenoxypropyl) hydrogen phosphate
bis(2-phenoxypropyl) hydrogen phosphate (PubChem CID 21023163) has the molecular formula C18H23O6P
and a molecular weight of 366.35 g/mol. Its IUPAC name is bis(2-phenoxypropyl) hydrogen phosphate.
Molecular Properties
| Compound Name | bis(2-phenoxypropyl) hydrogen phosphate |
| PubChem CID | 21023163 |
| Molecular Formula | C18H23O6P |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | bis(2-phenoxypropyl) hydrogen phosphate |
| SMILES | CC(COP(=O)(O)OCC(C)Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H23O6P/c1-15(23-17-9-5-3-6-10-17)13-21-25(19,20)22-14-16(2)24-18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3,(H,19,20) |
| InChIKey | FXFDHOWDOTWUBG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-phenoxypropyl) hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-phenoxypropyl) hydrogen phosphate?
The IUPAC name of bis(2-phenoxypropyl) hydrogen phosphate (CID 21023163) is bis(2-phenoxypropyl) hydrogen phosphate.
What is the SMILES notation for bis(2-phenoxypropyl) hydrogen phosphate?
The canonical SMILES for bis(2-phenoxypropyl) hydrogen phosphate is CC(COP(=O)(O)OCC(C)Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of bis(2-phenoxypropyl) hydrogen phosphate?
The InChIKey is FXFDHOWDOTWUBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23O6P/c1-15(23-17-9-5-3-6-10-17)13-21-25(19,20)22-14-16(2)24-18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3,(H,19,20).
What are the key properties of bis(2-phenoxypropyl) hydrogen phosphate?
bis(2-phenoxypropyl) hydrogen phosphate has a molecular weight of 366.35 g/mol, XLogP of 4.05, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-phenoxypropyl) hydrogen phosphate is sourced from PubChem (CID 21023163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).