About phenol;platinum;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine
phenol;platinum;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine (PubChem CID 21024827) has the molecular formula C22H17N2OPt-
and a molecular weight of 520.47 g/mol. Its IUPAC name is phenol;platinum;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine.
Molecular Properties
| Compound Name | phenol;platinum;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine |
| PubChem CID | 21024827 |
| Molecular Formula | C22H17N2OPt- |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | phenol;platinum;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine |
| SMILES | Oc1ccccc1.[Pt].[c-]1c(-c2ccccn2)cccc1-c1ccccn1 |
| InChI | InChI=1S/C16H11N2.C6H6O.Pt/c1-3-10-17-15(8-1)13-6-5-7-14(12-13)16-9-2-4-11-18-16;7-6-4-2-1-3-5-6;/h1-11H;1-5,7H;/q-1;; |
| InChIKey | ALWYMITTWREUIY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze phenol;platinum;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;platinum;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine?
The IUPAC name of phenol;platinum;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine (CID 21024827) is phenol;platinum;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine.
What is the SMILES notation for phenol;platinum;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine?
The canonical SMILES for phenol;platinum;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine is Oc1ccccc1.[Pt].[c-]1c(-c2ccccn2)cccc1-c1ccccn1.
What is the InChIKey of phenol;platinum;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine?
The InChIKey is ALWYMITTWREUIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N2.C6H6O.Pt/c1-3-10-17-15(8-1)13-6-5-7-14(12-13)16-9-2-4-11-18-16;7-6-4-2-1-3-5-6;/h1-11H;1-5,7H;/q-1;;.
What are the key properties of phenol;platinum;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine?
phenol;platinum;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine has a molecular weight of 520.47 g/mol, XLogP of 5.00, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;platinum;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine is sourced from PubChem (CID 21024827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).