C17H27NO2 — CID 21025600
N-(3-methoxy-4-propan-2-ylphenyl)-N,3,3-trimethylbutanamide (PubChem CID 21025600) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is N-(3-methoxy-4-propan-2-ylphenyl)-N,3,3-trimethylbutanamide.
| Compound Name | N-(3-methoxy-4-propan-2-ylphenyl)-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 21025600 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | N-(3-methoxy-4-propan-2-ylphenyl)-N,3,3-trimethylbutanamide |
| SMILES | COc1cc(N(C)C(=O)CC(C)(C)C)ccc1C(C)C |
| InChI | InChI=1S/C17H27NO2/c1-12(2)14-9-8-13(10-15(14)20-7)18(6)16(19)11-17(3,4)5/h8-10,12H,11H2,1-7H3 |
| InChIKey | JPYZYLYDHKLLGD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |