C19H31NO2 — CID 134557962
N-(4-tert-butyl-3-methoxyphenyl)-N,4,4-trimethylpentanamide (PubChem CID 134557962) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is N-(4-tert-butyl-3-methoxyphenyl)-N,4,4-trimethylpentanamide.
| Compound Name | N-(4-tert-butyl-3-methoxyphenyl)-N,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 134557962 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | N-(4-tert-butyl-3-methoxyphenyl)-N,4,4-trimethylpentanamide |
| SMILES | COc1cc(N(C)C(=O)CCC(C)(C)C)ccc1C(C)(C)C |
| InChI | InChI=1S/C19H31NO2/c1-18(2,3)12-11-17(21)20(7)14-9-10-15(19(4,5)6)16(13-14)22-8/h9-10,13H,11-12H2,1-8H3 |
| InChIKey | GUHOEBZEFMZXIJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |