C19H27NO4 — CID 21025715
ethyl 2-[2-(1,3-oxazinan-4-yl)-2-oxoethyl]-5-phenylpentanoate (PubChem CID 21025715) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is ethyl 2-[2-(1,3-oxazinan-4-yl)-2-oxoethyl]-5-phenylpentanoate.
| Compound Name | ethyl 2-[2-(1,3-oxazinan-4-yl)-2-oxoethyl]-5-phenylpentanoate |
|---|---|
| PubChem CID | 21025715 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | ethyl 2-[2-(1,3-oxazinan-4-yl)-2-oxoethyl]-5-phenylpentanoate |
| SMILES | CCOC(=O)C(CCCc1ccccc1)CC(=O)C1CCOCN1 |
| InChI | InChI=1S/C19H27NO4/c1-2-24-19(22)16(10-6-9-15-7-4-3-5-8-15)13-18(21)17-11-12-23-14-20-17/h3-5,7-8,16-17,20H,2,6,9-14H2,1H3 |
| InChIKey | CWKAAANNLPBDCB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |