About 3-(methylamino)propanoyl chloride
3-(methylamino)propanoyl chloride (PubChem CID 21027253) has the molecular formula C4H8ClNO
and a molecular weight of 121.57 g/mol. Its IUPAC name is 3-(methylamino)propanoyl chloride.
Molecular Properties
| Compound Name | 3-(methylamino)propanoyl chloride |
| PubChem CID | 21027253 |
| Molecular Formula | C4H8ClNO |
| Molecular Weight | 121.57 g/mol |
| Exact Mass | 121.03 |
| IUPAC Name | 3-(methylamino)propanoyl chloride |
| SMILES | CNCCC(=O)Cl |
| InChI | InChI=1S/C4H8ClNO/c1-6-3-2-4(5)7/h6H,2-3H2,1H3 |
| InChIKey | VEFYFMXSWVJVAA-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.57 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(methylamino)propanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylamino)propanoyl chloride?
The IUPAC name of 3-(methylamino)propanoyl chloride (CID 21027253) is 3-(methylamino)propanoyl chloride.
What is the SMILES notation for 3-(methylamino)propanoyl chloride?
The canonical SMILES for 3-(methylamino)propanoyl chloride is CNCCC(=O)Cl.
What is the InChIKey of 3-(methylamino)propanoyl chloride?
The InChIKey is VEFYFMXSWVJVAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8ClNO/c1-6-3-2-4(5)7/h6H,2-3H2,1H3.
What are the key properties of 3-(methylamino)propanoyl chloride?
3-(methylamino)propanoyl chloride has a molecular weight of 121.57 g/mol, XLogP of 0.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylamino)propanoyl chloride is sourced from PubChem (CID 21027253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).