3-(methylamino)propanoyl chloride

C4H8ClNO — CID 21027253

IUPAC3-(methylamino)propanoyl chloride
SMILESCNCCC(=O)Cl
InChIInChI=1S/C4H8ClNO/c1-6-3-2-4(5)7/h6H,2-3H2,1H3
InChIKeyVEFYFMXSWVJVAA-UHFFFAOYSA-N
MW121.57 g/mol
LogP0.36
Rot. Bonds3

About 3-(methylamino)propanoyl chloride

3-(methylamino)propanoyl chloride (PubChem CID 21027253) has the molecular formula C4H8ClNO and a molecular weight of 121.57 g/mol. Its IUPAC name is 3-(methylamino)propanoyl chloride.

Molecular Properties

Compound Name3-(methylamino)propanoyl chloride
PubChem CID21027253
Molecular FormulaC4H8ClNO
Molecular Weight121.57 g/mol
Exact Mass121.03
IUPAC Name3-(methylamino)propanoyl chloride
SMILESCNCCC(=O)Cl
InChIInChI=1S/C4H8ClNO/c1-6-3-2-4(5)7/h6H,2-3H2,1H3
InChIKeyVEFYFMXSWVJVAA-UHFFFAOYSA-N
XLogP0.36
TPSA29.10 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500121.57
LogP ≤ 50.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-(methylamino)propanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(methylamino)propanoyl chloride?
The IUPAC name of 3-(methylamino)propanoyl chloride (CID 21027253) is 3-(methylamino)propanoyl chloride.
What is the SMILES notation for 3-(methylamino)propanoyl chloride?
The canonical SMILES for 3-(methylamino)propanoyl chloride is CNCCC(=O)Cl.
What is the InChIKey of 3-(methylamino)propanoyl chloride?
The InChIKey is VEFYFMXSWVJVAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8ClNO/c1-6-3-2-4(5)7/h6H,2-3H2,1H3.
What are the key properties of 3-(methylamino)propanoyl chloride?
3-(methylamino)propanoyl chloride has a molecular weight of 121.57 g/mol, XLogP of 0.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylamino)propanoyl chloride is sourced from PubChem (CID 21027253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).