C18H25N3O3 — CID 21027337
methyl 2-[[2-(dimethylamino)-2-methylpropanoyl]amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 21027337) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is methyl 2-[[2-(dimethylamino)-2-methylpropanoyl]amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl 2-[[2-(dimethylamino)-2-methylpropanoyl]amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 21027337 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | methyl 2-[[2-(dimethylamino)-2-methylpropanoyl]amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(C)(C)N(C)C |
| InChI | InChI=1S/C18H25N3O3/c1-18(2,21(3)4)17(23)20-15(16(22)24-5)10-12-11-19-14-9-7-6-8-13(12)14/h6-9,11,15,19H,10H2,1-5H3,(H,20,23) |
| InChIKey | GFIVUEWSQQLKLC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |