C23H27N4O4S- — CID 21027825
3-oxo-2-[2-oxo-2-[2-(1-phenylpiperidin-4-yl)ethylamino]ethyl]-2,4-dihydroquinoxaline-1-sulfinate (PubChem CID 21027825) has the molecular formula C23H27N4O4S- and a molecular weight of 455.56 g/mol. Its IUPAC name is 3-oxo-2-[2-oxo-2-[2-(1-phenylpiperidin-4-yl)ethylamino]ethyl]-2,4-dihydroquinoxaline-1-sulfinate.
| Compound Name | 3-oxo-2-[2-oxo-2-[2-(1-phenylpiperidin-4-yl)ethylamino]ethyl]-2,4-dihydroquinoxaline-1-sulfinate |
|---|---|
| PubChem CID | 21027825 |
| Molecular Formula | C23H27N4O4S- |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 3-oxo-2-[2-oxo-2-[2-(1-phenylpiperidin-4-yl)ethylamino]ethyl]-2,4-dihydroquinoxaline-1-sulfinate |
| SMILES | O=C(CC1C(=O)Nc2ccccc2N1S(=O)[O-])NCCC1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H28N4O4S/c28-22(16-21-23(29)25-19-8-4-5-9-20(19)27(21)32(30)31)24-13-10-17-11-14-26(15-12-17)18-6-2-1-3-7-18/h1-9,17,21H,10-16H2,(H,24,28)(H,25,29)(H,30,31)/p-1 |
| InChIKey | LCGZBXUNGAGKMT-UHFFFAOYSA-M |
| XLogP | 2.42 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|