C17H24N4O4S — CID 21027828
3-oxo-2-[2-oxo-2-(2-piperidin-4-ylethylamino)ethyl]-2,4-dihydroquinoxaline-1-sulfinic acid (PubChem CID 21027828) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is 3-oxo-2-[2-oxo-2-(2-piperidin-4-ylethylamino)ethyl]-2,4-dihydroquinoxaline-1-sulfinic acid.
| Compound Name | 3-oxo-2-[2-oxo-2-(2-piperidin-4-ylethylamino)ethyl]-2,4-dihydroquinoxaline-1-sulfinic acid |
|---|---|
| PubChem CID | 21027828 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-oxo-2-[2-oxo-2-(2-piperidin-4-ylethylamino)ethyl]-2,4-dihydroquinoxaline-1-sulfinic acid |
| SMILES | O=C(CC1C(=O)Nc2ccccc2N1S(=O)O)NCCC1CCNCC1 |
| InChI | InChI=1S/C17H24N4O4S/c22-16(19-10-7-12-5-8-18-9-6-12)11-15-17(23)20-13-3-1-2-4-14(13)21(15)26(24)25/h1-4,12,15,18H,5-11H2,(H,19,22)(H,20,23)(H,24,25) |
| InChIKey | ZBEWQWAEVXJBGX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|