C18H23NO2S — CID 21030874
tert-butyl 2-amino-5-(3-phenylpropyl)thiophene-3-carboxylate (PubChem CID 21030874) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is tert-butyl 2-amino-5-(3-phenylpropyl)thiophene-3-carboxylate.
| Compound Name | tert-butyl 2-amino-5-(3-phenylpropyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 21030874 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | tert-butyl 2-amino-5-(3-phenylpropyl)thiophene-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc(CCCc2ccccc2)sc1N |
| InChI | InChI=1S/C18H23NO2S/c1-18(2,3)21-17(20)15-12-14(22-16(15)19)11-7-10-13-8-5-4-6-9-13/h4-6,8-9,12H,7,10-11,19H2,1-3H3 |
| InChIKey | NVVPTPGPZOJOSH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |