About [4-(6-hydroxyhexoxycarbonyloxymethyl)cyclohexyl]methyl 6-hydroxyhexyl carbonate
[4-(6-hydroxyhexoxycarbonyloxymethyl)cyclohexyl]methyl 6-hydroxyhexyl carbonate (PubChem CID 21031357) has the molecular formula C22H40O8
and a molecular weight of 432.55 g/mol. Its IUPAC name is [4-(6-hydroxyhexoxycarbonyloxymethyl)cyclohexyl]methyl 6-hydroxyhexyl carbonate.
Molecular Properties
| Compound Name | [4-(6-hydroxyhexoxycarbonyloxymethyl)cyclohexyl]methyl 6-hydroxyhexyl carbonate |
| PubChem CID | 21031357 |
| Molecular Formula | C22H40O8 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | [4-(6-hydroxyhexoxycarbonyloxymethyl)cyclohexyl]methyl 6-hydroxyhexyl carbonate |
| SMILES | O=C(OCCCCCCO)OCC1CCC(COC(=O)OCCCCCCO)CC1 |
| InChI | InChI=1S/C22H40O8/c23-13-5-1-3-7-15-27-21(25)29-17-19-9-11-20(12-10-19)18-30-22(26)28-16-8-4-2-6-14-24/h19-20,23-24H,1-18H2 |
| InChIKey | WUPDZJPZOXHIFK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-(6-hydroxyhexoxycarbonyloxymethyl)cyclohexyl]methyl 6-hydroxyhexyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(6-hydroxyhexoxycarbonyloxymethyl)cyclohexyl]methyl 6-hydroxyhexyl carbonate?
The IUPAC name of [4-(6-hydroxyhexoxycarbonyloxymethyl)cyclohexyl]methyl 6-hydroxyhexyl carbonate (CID 21031357) is [4-(6-hydroxyhexoxycarbonyloxymethyl)cyclohexyl]methyl 6-hydroxyhexyl carbonate.
What is the SMILES notation for [4-(6-hydroxyhexoxycarbonyloxymethyl)cyclohexyl]methyl 6-hydroxyhexyl carbonate?
The canonical SMILES for [4-(6-hydroxyhexoxycarbonyloxymethyl)cyclohexyl]methyl 6-hydroxyhexyl carbonate is O=C(OCCCCCCO)OCC1CCC(COC(=O)OCCCCCCO)CC1.
What is the InChIKey of [4-(6-hydroxyhexoxycarbonyloxymethyl)cyclohexyl]methyl 6-hydroxyhexyl carbonate?
The InChIKey is WUPDZJPZOXHIFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40O8/c23-13-5-1-3-7-15-27-21(25)29-17-19-9-11-20(12-10-19)18-30-22(26)28-16-8-4-2-6-14-24/h19-20,23-24H,1-18H2.
What are the key properties of [4-(6-hydroxyhexoxycarbonyloxymethyl)cyclohexyl]methyl 6-hydroxyhexyl carbonate?
[4-(6-hydroxyhexoxycarbonyloxymethyl)cyclohexyl]methyl 6-hydroxyhexyl carbonate has a molecular weight of 432.55 g/mol, XLogP of 4.20, 16 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(6-hydroxyhexoxycarbonyloxymethyl)cyclohexyl]methyl 6-hydroxyhexyl carbonate is sourced from PubChem (CID 21031357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).