About 2-chloroethyl cyclohexylmethyl carbonate
2-chloroethyl cyclohexylmethyl carbonate (PubChem CID 91697688) has the molecular formula C10H17ClO3
and a molecular weight of 220.70 g/mol. Its IUPAC name is 2-chloroethyl cyclohexylmethyl carbonate.
Molecular Properties
| Compound Name | 2-chloroethyl cyclohexylmethyl carbonate |
| PubChem CID | 91697688 |
| Molecular Formula | C10H17ClO3 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 2-chloroethyl cyclohexylmethyl carbonate |
| SMILES | O=C(OCCCl)OCC1CCCCC1 |
| InChI | InChI=1S/C10H17ClO3/c11-6-7-13-10(12)14-8-9-4-2-1-3-5-9/h9H,1-8H2 |
| InChIKey | ZVBGRKZOGKOZEI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethyl cyclohexylmethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethyl cyclohexylmethyl carbonate?
The IUPAC name of 2-chloroethyl cyclohexylmethyl carbonate (CID 91697688) is 2-chloroethyl cyclohexylmethyl carbonate.
What is the SMILES notation for 2-chloroethyl cyclohexylmethyl carbonate?
The canonical SMILES for 2-chloroethyl cyclohexylmethyl carbonate is O=C(OCCCl)OCC1CCCCC1.
What is the InChIKey of 2-chloroethyl cyclohexylmethyl carbonate?
The InChIKey is ZVBGRKZOGKOZEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17ClO3/c11-6-7-13-10(12)14-8-9-4-2-1-3-5-9/h9H,1-8H2.
What are the key properties of 2-chloroethyl cyclohexylmethyl carbonate?
2-chloroethyl cyclohexylmethyl carbonate has a molecular weight of 220.70 g/mol, XLogP of 2.96, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethyl cyclohexylmethyl carbonate is sourced from PubChem (CID 91697688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).