About 7-fluoro-10H-benzo[h]quinolin-10-ide;(Z)-4-hydroxypent-3-en-2-one;iridium
7-fluoro-10H-benzo[h]quinolin-10-ide;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 21032989) has the molecular formula C18H15FIrNO2-
and a molecular weight of 488.54 g/mol. Its IUPAC name is 7-fluoro-10H-benzo[h]quinolin-10-ide;(Z)-4-hydroxypent-3-en-2-one;iridium.
Molecular Properties
| Compound Name | 7-fluoro-10H-benzo[h]quinolin-10-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
| PubChem CID | 21032989 |
| Molecular Formula | C18H15FIrNO2- |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 7-fluoro-10H-benzo[h]quinolin-10-ide;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.Fc1cc[c-]c2c1ccc1cccnc12.[Ir] |
| InChI | InChI=1S/C13H7FN.C5H8O2.Ir/c14-12-5-1-4-11-10(12)7-6-9-3-2-8-15-13(9)11;1-4(6)3-5(2)7;/h1-3,5-8H;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | RBNGIPYKSOSGFH-LWFKIUJUSA-N |
| XLogP | 4.36 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-10H-benzo[h]quinolin-10-ide;(Z)-4-hydroxypent-3-en-2-one;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-10H-benzo[h]quinolin-10-ide;(Z)-4-hydroxypent-3-en-2-one;iridium?
The IUPAC name of 7-fluoro-10H-benzo[h]quinolin-10-ide;(Z)-4-hydroxypent-3-en-2-one;iridium (CID 21032989) is 7-fluoro-10H-benzo[h]quinolin-10-ide;(Z)-4-hydroxypent-3-en-2-one;iridium.
What is the SMILES notation for 7-fluoro-10H-benzo[h]quinolin-10-ide;(Z)-4-hydroxypent-3-en-2-one;iridium?
The canonical SMILES for 7-fluoro-10H-benzo[h]quinolin-10-ide;(Z)-4-hydroxypent-3-en-2-one;iridium is CC(=O)/C=C(/C)O.Fc1cc[c-]c2c1ccc1cccnc12.[Ir].
What is the InChIKey of 7-fluoro-10H-benzo[h]quinolin-10-ide;(Z)-4-hydroxypent-3-en-2-one;iridium?
The InChIKey is RBNGIPYKSOSGFH-LWFKIUJUSA-N. The full InChI is InChI=1S/C13H7FN.C5H8O2.Ir/c14-12-5-1-4-11-10(12)7-6-9-3-2-8-15-13(9)11;1-4(6)3-5(2)7;/h1-3,5-8H;3,6H,1-2H3;/q-1;;/b;4-3-;.
What are the key properties of 7-fluoro-10H-benzo[h]quinolin-10-ide;(Z)-4-hydroxypent-3-en-2-one;iridium?
7-fluoro-10H-benzo[h]quinolin-10-ide;(Z)-4-hydroxypent-3-en-2-one;iridium has a molecular weight of 488.54 g/mol, XLogP of 4.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-10H-benzo[h]quinolin-10-ide;(Z)-4-hydroxypent-3-en-2-one;iridium is sourced from PubChem (CID 21032989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).