C23H23N3OS — CID 21034463
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-(2-phenylethynyl)-6H-thieno[3,2-c]pyridine-5-carboxamide (PubChem CID 21034463) has the molecular formula C23H23N3OS and a molecular weight of 389.52 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-(2-phenylethynyl)-6H-thieno[3,2-c]pyridine-5-carboxamide.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-(2-phenylethynyl)-6H-thieno[3,2-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 21034463 |
| Molecular Formula | C23H23N3OS |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-2-(2-phenylethynyl)-6H-thieno[3,2-c]pyridine-5-carboxamide |
| SMILES | O=C(N[C@H]1CN2CCC1CC2)N1C=c2cc(C#Cc3ccccc3)sc2=CC1 |
| InChI | InChI=1S/C23H23N3OS/c27-23(24-21-16-25-11-8-18(21)9-12-25)26-13-10-22-19(15-26)14-20(28-22)7-6-17-4-2-1-3-5-17/h1-5,10,14-15,18,21H,8-9,11-13,16H2,(H,24,27)/t21-/m0/s1 |
| InChIKey | RICSUBFGBWAUQH-NRFANRHFSA-N |
| XLogP | 1.79 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|