C22H21N3OS — CID 20806911
N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-2-(2-phenylethynyl)-6H-thieno[3,2-c]pyridine-5-carboxamide (PubChem CID 20806911) has the molecular formula C22H21N3OS and a molecular weight of 375.50 g/mol. Its IUPAC name is N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-2-(2-phenylethynyl)-6H-thieno[3,2-c]pyridine-5-carboxamide.
| Compound Name | N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-2-(2-phenylethynyl)-6H-thieno[3,2-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 20806911 |
| Molecular Formula | C22H21N3OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[(4S)-1-azabicyclo[2.2.1]heptan-3-yl]-2-(2-phenylethynyl)-6H-thieno[3,2-c]pyridine-5-carboxamide |
| SMILES | O=C(NC1CN2CC[C@H]1C2)N1C=c2cc(C#Cc3ccccc3)sc2=CC1 |
| InChI | InChI=1S/C22H21N3OS/c26-22(23-20-15-24-10-8-17(20)13-24)25-11-9-21-18(14-25)12-19(27-21)7-6-16-4-2-1-3-5-16/h1-5,9,12,14,17,20H,8,10-11,13,15H2,(H,23,26)/t17-,20?/m0/s1 |
| InChIKey | FOMYMJNWSKVONE-DIMJTDRSSA-N |
| XLogP | 1.40 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|