C18H20N2O2S — CID 69301942
(5-phenylthiophen-2-yl) N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate (PubChem CID 69301942) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is (5-phenylthiophen-2-yl) N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate.
| Compound Name | (5-phenylthiophen-2-yl) N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate |
|---|---|
| PubChem CID | 69301942 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | (5-phenylthiophen-2-yl) N-(1-azabicyclo[2.2.2]octan-3-yl)carbamate |
| SMILES | O=C(NC1CN2CCC1CC2)Oc1ccc(-c2ccccc2)s1 |
| InChI | InChI=1S/C18H20N2O2S/c21-18(19-15-12-20-10-8-13(15)9-11-20)22-17-7-6-16(23-17)14-4-2-1-3-5-14/h1-7,13,15H,8-12H2,(H,19,21) |
| InChIKey | LSZHPTBXGDCBPK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |