C19H22N4O2S — CID 75070149
N-(1-azabicyclo[2.2.2]octan-3-yl)-2-(carbamoylamino)-5-phenylthiophene-3-carboxamide (PubChem CID 75070149) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-yl)-2-(carbamoylamino)-5-phenylthiophene-3-carboxamide.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-2-(carbamoylamino)-5-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 75070149 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-yl)-2-(carbamoylamino)-5-phenylthiophene-3-carboxamide |
| SMILES | NC(=O)Nc1sc(-c2ccccc2)cc1C(=O)NC1CN2CCC1CC2 |
| InChI | InChI=1S/C19H22N4O2S/c20-19(25)22-18-14(10-16(26-18)13-4-2-1-3-5-13)17(24)21-15-11-23-8-6-12(15)7-9-23/h1-5,10,12,15H,6-9,11H2,(H,21,24)(H3,20,22,25) |
| InChIKey | MUMLSZXBXFEQAV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |