C19H24N4O2S — CID 67078144
2-(carbamoylamino)-N-(1-ethylpiperidin-3-yl)-5-phenylthiophene-3-carboxamide (PubChem CID 67078144) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-(1-ethylpiperidin-3-yl)-5-phenylthiophene-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-N-(1-ethylpiperidin-3-yl)-5-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 67078144 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-(carbamoylamino)-N-(1-ethylpiperidin-3-yl)-5-phenylthiophene-3-carboxamide |
| SMILES | CCN1CCCC(NC(=O)c2cc(-c3ccccc3)sc2NC(N)=O)C1 |
| InChI | InChI=1S/C19H24N4O2S/c1-2-23-10-6-9-14(12-23)21-17(24)15-11-16(13-7-4-3-5-8-13)26-18(15)22-19(20)25/h3-5,7-8,11,14H,2,6,9-10,12H2,1H3,(H,21,24)(H3,20,22,25) |
| InChIKey | WVODRLOCFCHPBU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |