C20H26N4O4S — CID 69153019
[2-(carbamoylamino)-5-(4-methoxyphenyl)thiophen-3-yl] N-(1-ethylpiperidin-3-yl)carbamate (PubChem CID 69153019) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is [2-(carbamoylamino)-5-(4-methoxyphenyl)thiophen-3-yl] N-(1-ethylpiperidin-3-yl)carbamate.
| Compound Name | [2-(carbamoylamino)-5-(4-methoxyphenyl)thiophen-3-yl] N-(1-ethylpiperidin-3-yl)carbamate |
|---|---|
| PubChem CID | 69153019 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [2-(carbamoylamino)-5-(4-methoxyphenyl)thiophen-3-yl] N-(1-ethylpiperidin-3-yl)carbamate |
| SMILES | CCN1CCCC(NC(=O)Oc2cc(-c3ccc(OC)cc3)sc2NC(N)=O)C1 |
| InChI | InChI=1S/C20H26N4O4S/c1-3-24-10-4-5-14(12-24)22-20(26)28-16-11-17(29-18(16)23-19(21)25)13-6-8-15(27-2)9-7-13/h6-9,11,14H,3-5,10,12H2,1-2H3,(H,22,26)(H3,21,23,25) |
| InChIKey | NNXFSSRCUJFAKK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |