C19H24N4O4S — CID 69152628
[2-(carbamoylamino)-5-(4-methoxyphenyl)thiophen-3-yl] N-[(3R)-azepan-3-yl]carbamate (PubChem CID 69152628) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is [2-(carbamoylamino)-5-(4-methoxyphenyl)thiophen-3-yl] N-[(3R)-azepan-3-yl]carbamate.
| Compound Name | [2-(carbamoylamino)-5-(4-methoxyphenyl)thiophen-3-yl] N-[(3R)-azepan-3-yl]carbamate |
|---|---|
| PubChem CID | 69152628 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | [2-(carbamoylamino)-5-(4-methoxyphenyl)thiophen-3-yl] N-[(3R)-azepan-3-yl]carbamate |
| SMILES | COc1ccc(-c2cc(OC(=O)N[C@@H]3CCCCNC3)c(NC(N)=O)s2)cc1 |
| InChI | InChI=1S/C19H24N4O4S/c1-26-14-7-5-12(6-8-14)16-10-15(17(28-16)23-18(20)24)27-19(25)22-13-4-2-3-9-21-11-13/h5-8,10,13,21H,2-4,9,11H2,1H3,(H,22,25)(H3,20,23,24)/t13-/m1/s1 |
| InChIKey | NFBQUNYMWICWHM-CYBMUJFWSA-N |
| XLogP | 3.14 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |