C19H24N4O3S — CID 174506555
N-[(3S)-azepan-3-yl]-2-(carbamoylamino)-5-(2-methoxyphenyl)thiophene-3-carboxamide (PubChem CID 174506555) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[(3S)-azepan-3-yl]-2-(carbamoylamino)-5-(2-methoxyphenyl)thiophene-3-carboxamide.
| Compound Name | N-[(3S)-azepan-3-yl]-2-(carbamoylamino)-5-(2-methoxyphenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 174506555 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-[(3S)-azepan-3-yl]-2-(carbamoylamino)-5-(2-methoxyphenyl)thiophene-3-carboxamide |
| SMILES | COc1ccccc1-c1cc(C(=O)N[C@H]2CCCCNC2)c(NC(N)=O)s1 |
| InChI | InChI=1S/C19H24N4O3S/c1-26-15-8-3-2-7-13(15)16-10-14(18(27-16)23-19(20)25)17(24)22-12-6-4-5-9-21-11-12/h2-3,7-8,10,12,21H,4-6,9,11H2,1H3,(H,22,24)(H3,20,23,25)/t12-/m0/s1 |
| InChIKey | HLRJNMRURLZMTL-LBPRGKRZSA-N |
| XLogP | 2.79 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |