C17H20FN5O2S — CID 67077870
5-(4-amino-3-fluorophenyl)-2-(carbamoylamino)-N-[(3S)-piperidin-3-yl]thiophene-3-carboxamide (PubChem CID 67077870) has the molecular formula C17H20FN5O2S and a molecular weight of 377.45 g/mol. Its IUPAC name is 5-(4-amino-3-fluorophenyl)-2-(carbamoylamino)-N-[(3S)-piperidin-3-yl]thiophene-3-carboxamide.
| Compound Name | 5-(4-amino-3-fluorophenyl)-2-(carbamoylamino)-N-[(3S)-piperidin-3-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 67077870 |
| Molecular Formula | C17H20FN5O2S |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 5-(4-amino-3-fluorophenyl)-2-(carbamoylamino)-N-[(3S)-piperidin-3-yl]thiophene-3-carboxamide |
| SMILES | NC(=O)Nc1sc(-c2ccc(N)c(F)c2)cc1C(=O)N[C@H]1CCCNC1 |
| InChI | InChI=1S/C17H20FN5O2S/c18-12-6-9(3-4-13(12)19)14-7-11(16(26-14)23-17(20)25)15(24)22-10-2-1-5-21-8-10/h3-4,6-7,10,21H,1-2,5,8,19H2,(H,22,24)(H3,20,23,25)/t10-/m0/s1 |
| InChIKey | ITSUJDXRCYJXET-JTQLQIEISA-N |
| XLogP | 2.11 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|