C18H22N4O4S — CID 69153310
[2-(carbamoylamino)-5-(4-methoxyphenyl)thiophen-3-yl] N-[(3R)-piperidin-3-yl]carbamate (PubChem CID 69153310) has the molecular formula C18H22N4O4S and a molecular weight of 390.47 g/mol. Its IUPAC name is [2-(carbamoylamino)-5-(4-methoxyphenyl)thiophen-3-yl] N-[(3R)-piperidin-3-yl]carbamate.
| Compound Name | [2-(carbamoylamino)-5-(4-methoxyphenyl)thiophen-3-yl] N-[(3R)-piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 69153310 |
| Molecular Formula | C18H22N4O4S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | [2-(carbamoylamino)-5-(4-methoxyphenyl)thiophen-3-yl] N-[(3R)-piperidin-3-yl]carbamate |
| SMILES | COc1ccc(-c2cc(OC(=O)N[C@@H]3CCCNC3)c(NC(N)=O)s2)cc1 |
| InChI | InChI=1S/C18H22N4O4S/c1-25-13-6-4-11(5-7-13)15-9-14(16(27-15)22-17(19)23)26-18(24)21-12-3-2-8-20-10-12/h4-7,9,12,20H,2-3,8,10H2,1H3,(H,21,24)(H3,19,22,23)/t12-/m1/s1 |
| InChIKey | FAZPUNMKNXSDEB-GFCCVEGCSA-N |
| XLogP | 2.75 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |