C19H25ClN4O3S — CID 68960850
[3-[(3S)-3-aminoazepane-1-carbonyl]-5-(4-methoxyphenyl)thiophen-2-yl]urea;hydrochloride (PubChem CID 68960850) has the molecular formula C19H25ClN4O3S and a molecular weight of 424.95 g/mol. Its IUPAC name is [3-[(3S)-3-aminoazepane-1-carbonyl]-5-(4-methoxyphenyl)thiophen-2-yl]urea;hydrochloride.
| Compound Name | [3-[(3S)-3-aminoazepane-1-carbonyl]-5-(4-methoxyphenyl)thiophen-2-yl]urea;hydrochloride |
|---|---|
| PubChem CID | 68960850 |
| Molecular Formula | C19H25ClN4O3S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | [3-[(3S)-3-aminoazepane-1-carbonyl]-5-(4-methoxyphenyl)thiophen-2-yl]urea;hydrochloride |
| SMILES | COc1ccc(-c2cc(C(=O)N3CCCC[C@H](N)C3)c(NC(N)=O)s2)cc1.Cl |
| InChI | InChI=1S/C19H24N4O3S.ClH/c1-26-14-7-5-12(6-8-14)16-10-15(17(27-16)22-19(21)25)18(24)23-9-3-2-4-13(20)11-23;/h5-8,10,13H,2-4,9,11,20H2,1H3,(H3,21,22,25);1H/t13-;/m0./s1 |
| InChIKey | JRUFCVAKRGHONI-ZOWNYOTGSA-N |
| XLogP | 3.29 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |