C18H21ClN4O2S — CID 52946129
[3-[(3S)-3-aminoazepane-1-carbonyl]-5-(4-chlorophenyl)thiophen-2-yl]urea (PubChem CID 52946129) has the molecular formula C18H21ClN4O2S and a molecular weight of 392.91 g/mol. Its IUPAC name is [3-[(3S)-3-aminoazepane-1-carbonyl]-5-(4-chlorophenyl)thiophen-2-yl]urea.
| Compound Name | [3-[(3S)-3-aminoazepane-1-carbonyl]-5-(4-chlorophenyl)thiophen-2-yl]urea |
|---|---|
| PubChem CID | 52946129 |
| Molecular Formula | C18H21ClN4O2S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [3-[(3S)-3-aminoazepane-1-carbonyl]-5-(4-chlorophenyl)thiophen-2-yl]urea |
| SMILES | NC(=O)Nc1sc(-c2ccc(Cl)cc2)cc1C(=O)N1CCCC[C@H](N)C1 |
| InChI | InChI=1S/C18H21ClN4O2S/c19-12-6-4-11(5-7-12)15-9-14(16(26-15)22-18(21)25)17(24)23-8-2-1-3-13(20)10-23/h4-7,9,13H,1-3,8,10,20H2,(H3,21,22,25)/t13-/m0/s1 |
| InChIKey | MNBNRGSPKFNOBE-ZDUSSCGKSA-N |
| XLogP | 3.51 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |