C18H19ClN4O4S — CID 91195730
(1-carbamoylpiperidin-3-yl) 2-(carbamoylamino)-5-(4-chlorophenyl)thiophene-3-carboxylate (PubChem CID 91195730) has the molecular formula C18H19ClN4O4S and a molecular weight of 422.89 g/mol. Its IUPAC name is (1-carbamoylpiperidin-3-yl) 2-(carbamoylamino)-5-(4-chlorophenyl)thiophene-3-carboxylate.
| Compound Name | (1-carbamoylpiperidin-3-yl) 2-(carbamoylamino)-5-(4-chlorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 91195730 |
| Molecular Formula | C18H19ClN4O4S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (1-carbamoylpiperidin-3-yl) 2-(carbamoylamino)-5-(4-chlorophenyl)thiophene-3-carboxylate |
| SMILES | NC(=O)Nc1sc(-c2ccc(Cl)cc2)cc1C(=O)OC1CCCN(C(N)=O)C1 |
| InChI | InChI=1S/C18H19ClN4O4S/c19-11-5-3-10(4-6-11)14-8-13(15(28-14)22-17(20)25)16(24)27-12-2-1-7-23(9-12)18(21)26/h3-6,8,12H,1-2,7,9H2,(H2,21,26)(H3,20,22,25) |
| InChIKey | KMVMCOFVFGLCLM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |