C19H21ClN4O4S — CID 123791072
(1-carbamoylazepan-3-yl) 3-(carbamoylamino)-5-(3-chlorophenyl)thiophene-2-carboxylate (PubChem CID 123791072) has the molecular formula C19H21ClN4O4S and a molecular weight of 436.92 g/mol. Its IUPAC name is (1-carbamoylazepan-3-yl) 3-(carbamoylamino)-5-(3-chlorophenyl)thiophene-2-carboxylate.
| Compound Name | (1-carbamoylazepan-3-yl) 3-(carbamoylamino)-5-(3-chlorophenyl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 123791072 |
| Molecular Formula | C19H21ClN4O4S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | (1-carbamoylazepan-3-yl) 3-(carbamoylamino)-5-(3-chlorophenyl)thiophene-2-carboxylate |
| SMILES | NC(=O)Nc1cc(-c2cccc(Cl)c2)sc1C(=O)OC1CCCCN(C(N)=O)C1 |
| InChI | InChI=1S/C19H21ClN4O4S/c20-12-5-3-4-11(8-12)15-9-14(23-18(21)26)16(29-15)17(25)28-13-6-1-2-7-24(10-13)19(22)27/h3-5,8-9,13H,1-2,6-7,10H2,(H2,22,27)(H3,21,23,26) |
| InChIKey | CJRUKEGOHDYEHK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |