C18H19FN4O4S — CID 123686220
(1-carbamoylpiperidin-3-yl) 2-(carbamoylamino)-5-(2-fluorophenyl)thiophene-3-carboxylate (PubChem CID 123686220) has the molecular formula C18H19FN4O4S and a molecular weight of 406.44 g/mol. Its IUPAC name is (1-carbamoylpiperidin-3-yl) 2-(carbamoylamino)-5-(2-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | (1-carbamoylpiperidin-3-yl) 2-(carbamoylamino)-5-(2-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 123686220 |
| Molecular Formula | C18H19FN4O4S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | (1-carbamoylpiperidin-3-yl) 2-(carbamoylamino)-5-(2-fluorophenyl)thiophene-3-carboxylate |
| SMILES | NC(=O)Nc1sc(-c2ccccc2F)cc1C(=O)OC1CCCN(C(N)=O)C1 |
| InChI | InChI=1S/C18H19FN4O4S/c19-13-6-2-1-5-11(13)14-8-12(15(28-14)22-17(20)25)16(24)27-10-4-3-7-23(9-10)18(21)26/h1-2,5-6,8,10H,3-4,7,9H2,(H2,21,26)(H3,20,22,25) |
| InChIKey | RPFNFKDDHHAARX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |