C14H16N4O4S — CID 90818243
(1-carbamoylpiperidin-3-yl) 2-(carbamoylamino)-5-ethynylthiophene-3-carboxylate (PubChem CID 90818243) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is (1-carbamoylpiperidin-3-yl) 2-(carbamoylamino)-5-ethynylthiophene-3-carboxylate.
| Compound Name | (1-carbamoylpiperidin-3-yl) 2-(carbamoylamino)-5-ethynylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 90818243 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | (1-carbamoylpiperidin-3-yl) 2-(carbamoylamino)-5-ethynylthiophene-3-carboxylate |
| SMILES | C#Cc1cc(C(=O)OC2CCCN(C(N)=O)C2)c(NC(N)=O)s1 |
| InChI | InChI=1S/C14H16N4O4S/c1-2-9-6-10(11(23-9)17-13(15)20)12(19)22-8-4-3-5-18(7-8)14(16)21/h1,6,8H,3-5,7H2,(H2,16,21)(H3,15,17,20) |
| InChIKey | PVRGWDAZZNWTMN-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|